C17H17F2NO3 — CID 87005454
2,5-difluoro-N-[[3-(2-methoxyethoxy)phenyl]methyl]benzamide (PubChem CID 87005454) has the molecular formula C17H17F2NO3 and a molecular weight of 321.32 g/mol. Its IUPAC name is 2,5-difluoro-N-[[3-(2-methoxyethoxy)phenyl]methyl]benzamide.
| Compound Name | 2,5-difluoro-N-[[3-(2-methoxyethoxy)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 87005454 |
| Molecular Formula | C17H17F2NO3 |
| Molecular Weight | 321.32 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 2,5-difluoro-N-[[3-(2-methoxyethoxy)phenyl]methyl]benzamide |
| SMILES | COCCOc1cccc(CNC(=O)c2cc(F)ccc2F)c1 |
| InChI | InChI=1S/C17H17F2NO3/c1-22-7-8-23-14-4-2-3-12(9-14)11-20-17(21)15-10-13(18)5-6-16(15)19/h2-6,9-10H,7-8,11H2,1H3,(H,20,21) |
| InChIKey | NXJSKZDAVACPGQ-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.32 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|