C16H13ClFN3O2S — CID 78904085
N-[2-(4-chlorophenoxy)ethyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 78904085) has the molecular formula C16H13ClFN3O2S and a molecular weight of 365.82 g/mol. Its IUPAC name is N-[2-(4-chlorophenoxy)ethyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | N-[2-(4-chlorophenoxy)ethyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 78904085 |
| Molecular Formula | C16H13ClFN3O2S |
| Molecular Weight | 365.82 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | N-[2-(4-chlorophenoxy)ethyl]-6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | O=C(NCCOc1ccc(Cl)cc1)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C16H13ClFN3O2S/c17-9-1-3-11(4-2-9)23-6-5-19-15(22)12-7-10(18)8-13-14(12)21-16(24)20-13/h1-4,7-8H,5-6H2,(H,19,22)(H2,20,21,24) |
| InChIKey | ZWQBDYLAUNWQFN-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 69.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.82 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|