C16H11FN2O3 — CID 110863157
N-(1,3-benzodioxol-5-yl)-7-fluoro-1H-indole-2-carboxamide (PubChem CID 110863157) has the molecular formula C16H11FN2O3 and a molecular weight of 298.27 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-7-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-7-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 110863157 |
| Molecular Formula | C16H11FN2O3 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-7-fluoro-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)c1cc2cccc(F)c2[nH]1 |
| InChI | InChI=1S/C16H11FN2O3/c17-11-3-1-2-9-6-12(19-15(9)11)16(20)18-10-4-5-13-14(7-10)22-8-21-13/h1-7,19H,8H2,(H,18,20) |
| InChIKey | MJOOUVOOECWLCI-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |