C17H13FN2O3 — CID 110863160
N-(1,3-benzodioxol-5-yl)-4-fluoro-2-methyl-1H-indole-3-carboxamide (PubChem CID 110863160) has the molecular formula C17H13FN2O3 and a molecular weight of 312.30 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-4-fluoro-2-methyl-1H-indole-3-carboxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-4-fluoro-2-methyl-1H-indole-3-carboxamide |
|---|---|
| PubChem CID | 110863160 |
| Molecular Formula | C17H13FN2O3 |
| Molecular Weight | 312.30 g/mol |
| Exact Mass | 312.09 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-4-fluoro-2-methyl-1H-indole-3-carboxamide |
| SMILES | Cc1[nH]c2cccc(F)c2c1C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H13FN2O3/c1-9-15(16-11(18)3-2-4-12(16)19-9)17(21)20-10-5-6-13-14(7-10)23-8-22-13/h2-7,19H,8H2,1H3,(H,20,21) |
| InChIKey | JHZUMOKKFXEDEM-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.30 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |