C17H14FN3O2S — CID 111696420
6-fluoro-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide (PubChem CID 111696420) has the molecular formula C17H14FN3O2S and a molecular weight of 343.38 g/mol. Its IUPAC name is 6-fluoro-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide.
| Compound Name | 6-fluoro-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 111696420 |
| Molecular Formula | C17H14FN3O2S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 6-fluoro-N-(2-hydroxy-2,3-dihydro-1H-inden-1-yl)-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carboxamide |
| SMILES | O=C(NC1c2ccccc2CC1O)c1cc(F)cc2[nH]c(=S)[nH]c12 |
| InChI | InChI=1S/C17H14FN3O2S/c18-9-6-11(14-12(7-9)19-17(24)21-14)16(23)20-15-10-4-2-1-3-8(10)5-13(15)22/h1-4,6-7,13,15,22H,5H2,(H,20,23)(H2,19,21,24) |
| InChIKey | FPSZKRFIYSYYFI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|