C18H22FN5O2S — CID 78904204
N-cyclopropyl-2-[4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carbonyl)piperazin-1-yl]propanamide (PubChem CID 78904204) has the molecular formula C18H22FN5O2S and a molecular weight of 391.47 g/mol. Its IUPAC name is N-cyclopropyl-2-[4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carbonyl)piperazin-1-yl]propanamide.
| Compound Name | N-cyclopropyl-2-[4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carbonyl)piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 78904204 |
| Molecular Formula | C18H22FN5O2S |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-cyclopropyl-2-[4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carbonyl)piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)NC1CC1)N1CCN(C(=O)c2cc(F)cc3[nH]c(=S)[nH]c23)CC1 |
| InChI | InChI=1S/C18H22FN5O2S/c1-10(16(25)20-12-2-3-12)23-4-6-24(7-5-23)17(26)13-8-11(19)9-14-15(13)22-18(27)21-14/h8-10,12H,2-7H2,1H3,(H,20,25)(H2,21,22,27) |
| InChIKey | ALYYVBGQPZZJKK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|