C15H18FN3OS2 — CID 102560391
(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)-(3-methylsulfanylazepan-1-yl)methanone (PubChem CID 102560391) has the molecular formula C15H18FN3OS2 and a molecular weight of 339.46 g/mol. Its IUPAC name is (6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)-(3-methylsulfanylazepan-1-yl)methanone.
| Compound Name | (6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)-(3-methylsulfanylazepan-1-yl)methanone |
|---|---|
| PubChem CID | 102560391 |
| Molecular Formula | C15H18FN3OS2 |
| Molecular Weight | 339.46 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)-(3-methylsulfanylazepan-1-yl)methanone |
| SMILES | CSC1CCCCN(C(=O)c2cc(F)cc3[nH]c(=S)[nH]c23)C1 |
| InChI | InChI=1S/C15H18FN3OS2/c1-22-10-4-2-3-5-19(8-10)14(20)11-6-9(16)7-12-13(11)18-15(21)17-12/h6-7,10H,2-5,8H2,1H3,(H2,17,18,21) |
| InChIKey | BOYYHPWXBWLTNR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.46 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|