C20H21FN4O3S2 — CID 78903914
[4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)methanone (PubChem CID 78903914) has the molecular formula C20H21FN4O3S2 and a molecular weight of 448.55 g/mol. Its IUPAC name is [4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)methanone.
| Compound Name | [4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 78903914 |
| Molecular Formula | C20H21FN4O3S2 |
| Molecular Weight | 448.55 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | [4-(2,4-dimethylphenyl)sulfonylpiperazin-1-yl]-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)methanone |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)c3cc(F)cc4[nH]c(=S)[nH]c34)CC2)c(C)c1 |
| InChI | InChI=1S/C20H21FN4O3S2/c1-12-3-4-17(13(2)9-12)30(27,28)25-7-5-24(6-8-25)19(26)15-10-14(21)11-16-18(15)23-20(29)22-16/h3-4,9-11H,5-8H2,1-2H3,(H2,22,23,29) |
| InChIKey | KQMSMMQWHJXRGD-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.55 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|