C18H17FN4O3S2 — CID 78903917
[4-(benzenesulfonyl)piperazin-1-yl]-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)methanone (PubChem CID 78903917) has the molecular formula C18H17FN4O3S2 and a molecular weight of 420.49 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)methanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)methanone |
|---|---|
| PubChem CID | 78903917 |
| Molecular Formula | C18H17FN4O3S2 |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazol-4-yl)methanone |
| SMILES | O=C(c1cc(F)cc2[nH]c(=S)[nH]c12)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C18H17FN4O3S2/c19-12-10-14(16-15(11-12)20-18(27)21-16)17(24)22-6-8-23(9-7-22)28(25,26)13-4-2-1-3-5-13/h1-5,10-11H,6-9H2,(H2,20,21,27) |
| InChIKey | XSZZHOVLTYTEJR-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 89.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|