C17H16F2N2O3S — CID 2225542
[4-(benzenesulfonyl)piperazin-1-yl]-(2,6-difluorophenyl)methanone (PubChem CID 2225542) has the molecular formula C17H16F2N2O3S and a molecular weight of 366.39 g/mol. Its IUPAC name is [4-(benzenesulfonyl)piperazin-1-yl]-(2,6-difluorophenyl)methanone.
| Compound Name | [4-(benzenesulfonyl)piperazin-1-yl]-(2,6-difluorophenyl)methanone |
|---|---|
| PubChem CID | 2225542 |
| Molecular Formula | C17H16F2N2O3S |
| Molecular Weight | 366.39 g/mol |
| Exact Mass | 366.08 |
| IUPAC Name | [4-(benzenesulfonyl)piperazin-1-yl]-(2,6-difluorophenyl)methanone |
| SMILES | O=C(c1c(F)cccc1F)N1CCN(S(=O)(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C17H16F2N2O3S/c18-14-7-4-8-15(19)16(14)17(22)20-9-11-21(12-10-20)25(23,24)13-5-2-1-3-6-13/h1-8H,9-12H2 |
| InChIKey | YFEPLHFLCXKBMC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |