C19H20FN3O4S — CID 27510219
N-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-2-fluorobenzamide (PubChem CID 27510219) has the molecular formula C19H20FN3O4S and a molecular weight of 405.45 g/mol. Its IUPAC name is N-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 27510219 |
| Molecular Formula | C19H20FN3O4S |
| Molecular Weight | 405.45 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | N-[2-[4-(benzenesulfonyl)piperazin-1-yl]-2-oxoethyl]-2-fluorobenzamide |
| SMILES | O=C(NCC(=O)N1CCN(S(=O)(=O)c2ccccc2)CC1)c1ccccc1F |
| InChI | InChI=1S/C19H20FN3O4S/c20-17-9-5-4-8-16(17)19(25)21-14-18(24)22-10-12-23(13-11-22)28(26,27)15-6-2-1-3-7-15/h1-9H,10-14H2,(H,21,25) |
| InChIKey | DBRYVQCWDZECQE-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.45 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |