C13H15FN2O4 — CID 106671856
N-[2-(3,4-dihydroxypyrrolidin-1-yl)-2-oxoethyl]-2-fluorobenzamide (PubChem CID 106671856) has the molecular formula C13H15FN2O4 and a molecular weight of 282.27 g/mol. Its IUPAC name is N-[2-(3,4-dihydroxypyrrolidin-1-yl)-2-oxoethyl]-2-fluorobenzamide.
| Compound Name | N-[2-(3,4-dihydroxypyrrolidin-1-yl)-2-oxoethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 106671856 |
| Molecular Formula | C13H15FN2O4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-[2-(3,4-dihydroxypyrrolidin-1-yl)-2-oxoethyl]-2-fluorobenzamide |
| SMILES | O=C(NCC(=O)N1CC(O)C(O)C1)c1ccccc1F |
| InChI | InChI=1S/C13H15FN2O4/c14-9-4-2-1-3-8(9)13(20)15-5-12(19)16-6-10(17)11(18)7-16/h1-4,10-11,17-18H,5-7H2,(H,15,20) |
| InChIKey | CLDDYWWTKMATFD-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |