C21H20ClF2N3O3 — CID 86898999
2-chloro-6-fluoro-N-[2-[4-[(2-fluorobenzoyl)amino]piperidin-1-yl]-2-oxoethyl]benzamide (PubChem CID 86898999) has the molecular formula C21H20ClF2N3O3 and a molecular weight of 435.86 g/mol. Its IUPAC name is 2-chloro-6-fluoro-N-[2-[4-[(2-fluorobenzoyl)amino]piperidin-1-yl]-2-oxoethyl]benzamide.
| Compound Name | 2-chloro-6-fluoro-N-[2-[4-[(2-fluorobenzoyl)amino]piperidin-1-yl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 86898999 |
| Molecular Formula | C21H20ClF2N3O3 |
| Molecular Weight | 435.86 g/mol |
| Exact Mass | 435.12 |
| IUPAC Name | 2-chloro-6-fluoro-N-[2-[4-[(2-fluorobenzoyl)amino]piperidin-1-yl]-2-oxoethyl]benzamide |
| SMILES | O=C(NC1CCN(C(=O)CNC(=O)c2c(F)cccc2Cl)CC1)c1ccccc1F |
| InChI | InChI=1S/C21H20ClF2N3O3/c22-15-5-3-7-17(24)19(15)21(30)25-12-18(28)27-10-8-13(9-11-27)26-20(29)14-4-1-2-6-16(14)23/h1-7,13H,8-12H2,(H,25,30)(H,26,29) |
| InChIKey | IDMDYGFCNIVTOR-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.86 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |