C20H17ClF4N2O2 — CID 166358082
2-chloro-N-[1-(2-fluorobenzoyl)piperidin-4-yl]-6-(trifluoromethyl)benzamide (PubChem CID 166358082) has the molecular formula C20H17ClF4N2O2 and a molecular weight of 428.81 g/mol. Its IUPAC name is 2-chloro-N-[1-(2-fluorobenzoyl)piperidin-4-yl]-6-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-[1-(2-fluorobenzoyl)piperidin-4-yl]-6-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 166358082 |
| Molecular Formula | C20H17ClF4N2O2 |
| Molecular Weight | 428.81 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | 2-chloro-N-[1-(2-fluorobenzoyl)piperidin-4-yl]-6-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccccc2F)CC1)c1c(Cl)cccc1C(F)(F)F |
| InChI | InChI=1S/C20H17ClF4N2O2/c21-15-6-3-5-14(20(23,24)25)17(15)18(28)26-12-8-10-27(11-9-12)19(29)13-4-1-2-7-16(13)22/h1-7,12H,8-11H2,(H,26,28) |
| InChIKey | YBWLZBLIQWARLK-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.81 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |