C20H18F4N2O2 — CID 108555137
N-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-(trifluoromethyl)benzamide (PubChem CID 108555137) has the molecular formula C20H18F4N2O2 and a molecular weight of 394.37 g/mol. Its IUPAC name is N-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 108555137 |
| Molecular Formula | C20H18F4N2O2 |
| Molecular Weight | 394.37 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | N-[1-(4-fluorobenzoyl)piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccc(F)cc2)CC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C20H18F4N2O2/c21-14-7-5-13(6-8-14)19(28)26-11-9-15(10-12-26)25-18(27)16-3-1-2-4-17(16)20(22,23)24/h1-8,15H,9-12H2,(H,25,27) |
| InChIKey | JBTLJIATVYXSBP-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |