C18H17F3N2O3 — CID 38215685
N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-(trifluoromethyl)benzamide (PubChem CID 38215685) has the molecular formula C18H17F3N2O3 and a molecular weight of 366.34 g/mol. Its IUPAC name is N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 38215685 |
| Molecular Formula | C18H17F3N2O3 |
| Molecular Weight | 366.34 g/mol |
| Exact Mass | 366.12 |
| IUPAC Name | N-[1-(furan-3-carbonyl)piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCN(C(=O)c2ccoc2)CC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H17F3N2O3/c19-18(20,21)15-4-2-1-3-14(15)16(24)22-13-5-8-23(9-6-13)17(25)12-7-10-26-11-12/h1-4,7,10-11,13H,5-6,8-9H2,(H,22,24) |
| InChIKey | BOQLSCAZXOKVHU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.34 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |