C33H32F3N3O2 — CID 171684796
N-[1-[1-[4-(2-phenylethynyl)benzoyl]piperidin-4-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide (PubChem CID 171684796) has the molecular formula C33H32F3N3O2 and a molecular weight of 559.63 g/mol. Its IUPAC name is N-[1-[1-[4-(2-phenylethynyl)benzoyl]piperidin-4-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[1-[4-(2-phenylethynyl)benzoyl]piperidin-4-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 171684796 |
| Molecular Formula | C33H32F3N3O2 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.24 |
| IUPAC Name | N-[1-[1-[4-(2-phenylethynyl)benzoyl]piperidin-4-yl]piperidin-4-yl]-2-(trifluoromethyl)benzamide |
| SMILES | O=C(NC1CCN(C2CCN(C(=O)c3ccc(C#Cc4ccccc4)cc3)CC2)CC1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C33H32F3N3O2/c34-33(35,36)30-9-5-4-8-29(30)31(40)37-27-16-20-38(21-17-27)28-18-22-39(23-19-28)32(41)26-14-12-25(13-15-26)11-10-24-6-2-1-3-7-24/h1-9,12-15,27-28H,16-23H2,(H,37,40) |
| InChIKey | XRJUTPLVUDDTSP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|