C33H33F2N3O3 — CID 171684811
2,6-difluoro-4-methoxy-N-[1-[1-[4-(2-phenylethynyl)benzoyl]piperidin-4-yl]piperidin-4-yl]benzamide (PubChem CID 171684811) has the molecular formula C33H33F2N3O3 and a molecular weight of 557.64 g/mol. Its IUPAC name is 2,6-difluoro-4-methoxy-N-[1-[1-[4-(2-phenylethynyl)benzoyl]piperidin-4-yl]piperidin-4-yl]benzamide.
| Compound Name | 2,6-difluoro-4-methoxy-N-[1-[1-[4-(2-phenylethynyl)benzoyl]piperidin-4-yl]piperidin-4-yl]benzamide |
|---|---|
| PubChem CID | 171684811 |
| Molecular Formula | C33H33F2N3O3 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.25 |
| IUPAC Name | 2,6-difluoro-4-methoxy-N-[1-[1-[4-(2-phenylethynyl)benzoyl]piperidin-4-yl]piperidin-4-yl]benzamide |
| SMILES | COc1cc(F)c(C(=O)NC2CCN(C3CCN(C(=O)c4ccc(C#Cc5ccccc5)cc4)CC3)CC2)c(F)c1 |
| InChI | InChI=1S/C33H33F2N3O3/c1-41-28-21-29(34)31(30(35)22-28)32(39)36-26-13-17-37(18-14-26)27-15-19-38(20-16-27)33(40)25-11-9-24(10-12-25)8-7-23-5-3-2-4-6-23/h2-6,9-12,21-22,26-27H,13-20H2,1H3,(H,36,39) |
| InChIKey | FLAKXXLCMPZXBV-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|