C33H33F2N3O2S — CID 171684976
N-[1-[1-[2-(2,4-difluorophenyl)sulfanylacetyl]piperidin-4-yl]piperidin-4-yl]-4-(2-phenylethynyl)benzamide (PubChem CID 171684976) has the molecular formula C33H33F2N3O2S and a molecular weight of 573.71 g/mol. Its IUPAC name is N-[1-[1-[2-(2,4-difluorophenyl)sulfanylacetyl]piperidin-4-yl]piperidin-4-yl]-4-(2-phenylethynyl)benzamide.
| Compound Name | N-[1-[1-[2-(2,4-difluorophenyl)sulfanylacetyl]piperidin-4-yl]piperidin-4-yl]-4-(2-phenylethynyl)benzamide |
|---|---|
| PubChem CID | 171684976 |
| Molecular Formula | C33H33F2N3O2S |
| Molecular Weight | 573.71 g/mol |
| Exact Mass | 573.23 |
| IUPAC Name | N-[1-[1-[2-(2,4-difluorophenyl)sulfanylacetyl]piperidin-4-yl]piperidin-4-yl]-4-(2-phenylethynyl)benzamide |
| SMILES | O=C(NC1CCN(C2CCN(C(=O)CSc3ccc(F)cc3F)CC2)CC1)c1ccc(C#Cc2ccccc2)cc1 |
| InChI | InChI=1S/C33H33F2N3O2S/c34-27-12-13-31(30(35)22-27)41-23-32(39)38-20-16-29(17-21-38)37-18-14-28(15-19-37)36-33(40)26-10-8-25(9-11-26)7-6-24-4-2-1-3-5-24/h1-5,8-13,22,28-29H,14-21,23H2,(H,36,40) |
| InChIKey | GPAPKDSQECXENL-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|