C25H26N2O4 — CID 108554010
N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]naphthalene-1-carboxamide (PubChem CID 108554010) has the molecular formula C25H26N2O4 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]naphthalene-1-carboxamide.
| Compound Name | N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]naphthalene-1-carboxamide |
|---|---|
| PubChem CID | 108554010 |
| Molecular Formula | C25H26N2O4 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-[1-(3,5-dimethoxybenzoyl)piperidin-4-yl]naphthalene-1-carboxamide |
| SMILES | COc1cc(OC)cc(C(=O)N2CCC(NC(=O)c3cccc4ccccc34)CC2)c1 |
| InChI | InChI=1S/C25H26N2O4/c1-30-20-14-18(15-21(16-20)31-2)25(29)27-12-10-19(11-13-27)26-24(28)23-9-5-7-17-6-3-4-8-22(17)23/h3-9,14-16,19H,10-13H2,1-2H3,(H,26,28) |
| InChIKey | MVBHEQVJBQAOEG-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |