C22H17F6NO2 — CID 53338949
[4-[2-[2,6-bis(trifluoromethyl)phenyl]ethynyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 53338949) has the molecular formula C22H17F6NO2 and a molecular weight of 441.37 g/mol. Its IUPAC name is [4-[2-[2,6-bis(trifluoromethyl)phenyl]ethynyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [4-[2-[2,6-bis(trifluoromethyl)phenyl]ethynyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 53338949 |
| Molecular Formula | C22H17F6NO2 |
| Molecular Weight | 441.37 g/mol |
| Exact Mass | 441.12 |
| IUPAC Name | [4-[2-[2,6-bis(trifluoromethyl)phenyl]ethynyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(C#Cc2c(C(F)(F)F)cccc2C(F)(F)F)cc1)N1CCC(O)CC1 |
| InChI | InChI=1S/C22H17F6NO2/c23-21(24,25)18-2-1-3-19(22(26,27)28)17(18)9-6-14-4-7-15(8-5-14)20(31)29-12-10-16(30)11-13-29/h1-5,7-8,16,30H,10-13H2 |
| InChIKey | KVLWGHYIQDUIBZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|