C22H22FNO3 — CID 53338939
[4-[3-(3-fluorophenyl)-3-hydroxybut-1-ynyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 53338939) has the molecular formula C22H22FNO3 and a molecular weight of 367.42 g/mol. Its IUPAC name is [4-[3-(3-fluorophenyl)-3-hydroxybut-1-ynyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [4-[3-(3-fluorophenyl)-3-hydroxybut-1-ynyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 53338939 |
| Molecular Formula | C22H22FNO3 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.16 |
| IUPAC Name | [4-[3-(3-fluorophenyl)-3-hydroxybut-1-ynyl]phenyl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | CC(O)(C#Cc1ccc(C(=O)N2CCC(O)CC2)cc1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H22FNO3/c1-22(27,18-3-2-4-19(23)15-18)12-9-16-5-7-17(8-6-16)21(26)24-13-10-20(25)11-14-24/h2-8,15,20,25,27H,10-11,13-14H2,1H3 |
| InChIKey | PJEHJDYMWGBGCD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|