C20H25NO2 — CID 53338955
[4-(2-cyclohexylethynyl)phenyl]-(4-hydroxypiperidin-1-yl)methanone (PubChem CID 53338955) has the molecular formula C20H25NO2 and a molecular weight of 311.42 g/mol. Its IUPAC name is [4-(2-cyclohexylethynyl)phenyl]-(4-hydroxypiperidin-1-yl)methanone.
| Compound Name | [4-(2-cyclohexylethynyl)phenyl]-(4-hydroxypiperidin-1-yl)methanone |
|---|---|
| PubChem CID | 53338955 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.42 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | [4-(2-cyclohexylethynyl)phenyl]-(4-hydroxypiperidin-1-yl)methanone |
| SMILES | O=C(c1ccc(C#CC2CCCCC2)cc1)N1CCC(O)CC1 |
| InChI | InChI=1S/C20H25NO2/c22-19-12-14-21(15-13-19)20(23)18-10-8-17(9-11-18)7-6-16-4-2-1-3-5-16/h8-11,16,19,22H,1-5,12-15H2 |
| InChIKey | IYCDDBUVASVMAO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.42 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|