C23H21FN2O7S — CID 171154796
[4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-naphthalen-1-ylmethanone;oxalic acid (PubChem CID 171154796) has the molecular formula C23H21FN2O7S and a molecular weight of 488.49 g/mol. Its IUPAC name is [4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-naphthalen-1-ylmethanone;oxalic acid.
| Compound Name | [4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-naphthalen-1-ylmethanone;oxalic acid |
|---|---|
| PubChem CID | 171154796 |
| Molecular Formula | C23H21FN2O7S |
| Molecular Weight | 488.49 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | [4-(4-fluorophenyl)sulfonylpiperazin-1-yl]-naphthalen-1-ylmethanone;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(c1cccc2ccccc12)N1CCN(S(=O)(=O)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H19FN2O3S.C2H2O4/c22-17-8-10-18(11-9-17)28(26,27)24-14-12-23(13-15-24)21(25)20-7-3-5-16-4-1-2-6-19(16)20;3-1(4)2(5)6/h1-11H,12-15H2;(H,3,4)(H,5,6) |
| InChIKey | ZUMLAIDFGKNSEQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 132.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|