C27H32N2O5 — CID 2927253
[4-(2-adamantyl)piperazin-1-yl]-naphthalen-1-ylmethanone;oxalic acid (PubChem CID 2927253) has the molecular formula C27H32N2O5 and a molecular weight of 464.56 g/mol. Its IUPAC name is [4-(2-adamantyl)piperazin-1-yl]-naphthalen-1-ylmethanone;oxalic acid.
| Compound Name | [4-(2-adamantyl)piperazin-1-yl]-naphthalen-1-ylmethanone;oxalic acid |
|---|---|
| PubChem CID | 2927253 |
| Molecular Formula | C27H32N2O5 |
| Molecular Weight | 464.56 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | [4-(2-adamantyl)piperazin-1-yl]-naphthalen-1-ylmethanone;oxalic acid |
| SMILES | O=C(O)C(=O)O.O=C(c1cccc2ccccc12)N1CCN(C2C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C25H30N2O.C2H2O4/c28-25(23-7-3-5-19-4-1-2-6-22(19)23)27-10-8-26(9-11-27)24-20-13-17-12-18(15-20)16-21(24)14-17;3-1(4)2(5)6/h1-7,17-18,20-21,24H,8-16H2;(H,3,4)(H,5,6) |
| InChIKey | XSTWNFNSPALQSS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.56 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|