C19H26N2OS — CID 764441
[4-(2-adamantyl)piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 764441) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is [4-(2-adamantyl)piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(2-adamantyl)piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 764441 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | [4-(2-adamantyl)piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCN(C2C3CC4CC(C3)CC2C4)CC1 |
| InChI | InChI=1S/C19H26N2OS/c22-19(17-2-1-7-23-17)21-5-3-20(4-6-21)18-15-9-13-8-14(11-15)12-16(18)10-13/h1-2,7,13-16,18H,3-6,8-12H2 |
| InChIKey | VEKQJSSAEBLXKR-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |