C18H22N4OS — CID 75950255
[4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]-thiophen-2-ylmethanone (PubChem CID 75950255) has the molecular formula C18H22N4OS and a molecular weight of 342.47 g/mol. Its IUPAC name is [4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]-thiophen-2-ylmethanone.
| Compound Name | [4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 75950255 |
| Molecular Formula | C18H22N4OS |
| Molecular Weight | 342.47 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | [4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]-thiophen-2-ylmethanone |
| SMILES | O=C(c1cccs1)N1CCN(C2CC(c3ccccc3)NN2)CC1 |
| InChI | InChI=1S/C18H22N4OS/c23-18(16-7-4-12-24-16)22-10-8-21(9-11-22)17-13-15(19-20-17)14-5-2-1-3-6-14/h1-7,12,15,17,19-20H,8-11,13H2 |
| InChIKey | HWMLCUAAGUYSRX-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |