C21H25ClN4O2 — CID 134088263
(5-chloro-2-methoxyphenyl)-[4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]methanone (PubChem CID 134088263) has the molecular formula C21H25ClN4O2 and a molecular weight of 400.91 g/mol. Its IUPAC name is (5-chloro-2-methoxyphenyl)-[4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]methanone.
| Compound Name | (5-chloro-2-methoxyphenyl)-[4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 134088263 |
| Molecular Formula | C21H25ClN4O2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | (5-chloro-2-methoxyphenyl)-[4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]methanone |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCN(C2CC(c3ccccc3)NN2)CC1 |
| InChI | InChI=1S/C21H25ClN4O2/c1-28-19-8-7-16(22)13-17(19)21(27)26-11-9-25(10-12-26)20-14-18(23-24-20)15-5-3-2-4-6-15/h2-8,13,18,20,23-24H,9-12,14H2,1H3 |
| InChIKey | FNVGODOHRDBODA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |