C20H22ClFN4O — CID 134088281
[4-[5-(4-chlorophenyl)pyrazolidin-3-yl]piperazin-1-yl]-(2-fluorophenyl)methanone (PubChem CID 134088281) has the molecular formula C20H22ClFN4O and a molecular weight of 388.87 g/mol. Its IUPAC name is [4-[5-(4-chlorophenyl)pyrazolidin-3-yl]piperazin-1-yl]-(2-fluorophenyl)methanone.
| Compound Name | [4-[5-(4-chlorophenyl)pyrazolidin-3-yl]piperazin-1-yl]-(2-fluorophenyl)methanone |
|---|---|
| PubChem CID | 134088281 |
| Molecular Formula | C20H22ClFN4O |
| Molecular Weight | 388.87 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | [4-[5-(4-chlorophenyl)pyrazolidin-3-yl]piperazin-1-yl]-(2-fluorophenyl)methanone |
| SMILES | O=C(c1ccccc1F)N1CCN(C2CC(c3ccc(Cl)cc3)NN2)CC1 |
| InChI | InChI=1S/C20H22ClFN4O/c21-15-7-5-14(6-8-15)18-13-19(24-23-18)25-9-11-26(12-10-25)20(27)16-3-1-2-4-17(16)22/h1-8,18-19,23-24H,9-13H2 |
| InChIKey | UQVHVJNUZLNWME-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.87 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |