C20H22Cl2N4O — CID 134088241
(2,5-dichlorophenyl)-[4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]methanone (PubChem CID 134088241) has the molecular formula C20H22Cl2N4O and a molecular weight of 405.33 g/mol. Its IUPAC name is (2,5-dichlorophenyl)-[4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]methanone.
| Compound Name | (2,5-dichlorophenyl)-[4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 134088241 |
| Molecular Formula | C20H22Cl2N4O |
| Molecular Weight | 405.33 g/mol |
| Exact Mass | 404.12 |
| IUPAC Name | (2,5-dichlorophenyl)-[4-(5-phenylpyrazolidin-3-yl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(Cl)ccc1Cl)N1CCN(C2CC(c3ccccc3)NN2)CC1 |
| InChI | InChI=1S/C20H22Cl2N4O/c21-15-6-7-17(22)16(12-15)20(27)26-10-8-25(9-11-26)19-13-18(23-24-19)14-4-2-1-3-5-14/h1-7,12,18-19,23-24H,8-11,13H2 |
| InChIKey | BFTRQUANPHCMGQ-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.33 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |