C19H17FN4O2S — CID 78904546
[4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carbonyl)piperazin-1-yl]-phenylmethanone (PubChem CID 78904546) has the molecular formula C19H17FN4O2S and a molecular weight of 384.44 g/mol. Its IUPAC name is [4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carbonyl)piperazin-1-yl]-phenylmethanone.
| Compound Name | [4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carbonyl)piperazin-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 78904546 |
| Molecular Formula | C19H17FN4O2S |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | [4-(6-fluoro-2-sulfanylidene-1,3-dihydrobenzimidazole-4-carbonyl)piperazin-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CCN(C(=O)c2cc(F)cc3[nH]c(=S)[nH]c23)CC1 |
| InChI | InChI=1S/C19H17FN4O2S/c20-13-10-14(16-15(11-13)21-19(27)22-16)18(26)24-8-6-23(7-9-24)17(25)12-4-2-1-3-5-12/h1-5,10-11H,6-9H2,(H2,21,22,27) |
| InChIKey | JWWNGUNHIBZIDH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|