C17H23N3O2 — CID 97387986
(3aS,4R,7aS)-6-prop-2-enyl-N-(pyridin-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide (PubChem CID 97387986) has the molecular formula C17H23N3O2 and a molecular weight of 301.39 g/mol. Its IUPAC name is (3aS,4R,7aS)-6-prop-2-enyl-N-(pyridin-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide.
| Compound Name | (3aS,4R,7aS)-6-prop-2-enyl-N-(pyridin-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 97387986 |
| Molecular Formula | C17H23N3O2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.18 |
| IUPAC Name | (3aS,4R,7aS)-6-prop-2-enyl-N-(pyridin-2-ylmethyl)-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridine-4-carboxamide |
| SMILES | C=CCN1C[C@H](C(=O)NCc2ccccn2)[C@@H]2CCO[C@@H]2C1 |
| InChI | InChI=1S/C17H23N3O2/c1-2-8-20-11-15(14-6-9-22-16(14)12-20)17(21)19-10-13-5-3-4-7-18-13/h2-5,7,14-16H,1,6,8-12H2,(H,19,21)/t14-,15-,16+/m0/s1 |
| InChIKey | JZZXXGLNGYJMEQ-HRCADAONSA-N |
| XLogP | 1.22 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|