C14H23F3N2O3 — CID 100897904
1-[(3aS,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea (PubChem CID 100897904) has the molecular formula C14H23F3N2O3 and a molecular weight of 324.34 g/mol. Its IUPAC name is 1-[(3aS,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea.
| Compound Name | 1-[(3aS,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea |
|---|---|
| PubChem CID | 100897904 |
| Molecular Formula | C14H23F3N2O3 |
| Molecular Weight | 324.34 g/mol |
| Exact Mass | 324.17 |
| IUPAC Name | 1-[(3aS,4R,7aS)-2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl]-3-[3-(2,2,2-trifluoroethoxy)propyl]urea |
| SMILES | O=C(NCCCOCC(F)(F)F)N[C@@H]1CCC[C@@H]2OCC[C@H]21 |
| InChI | InChI=1S/C14H23F3N2O3/c15-14(16,17)9-21-7-2-6-18-13(20)19-11-3-1-4-12-10(11)5-8-22-12/h10-12H,1-9H2,(H2,18,19,20)/t10-,11+,12-/m0/s1 |
| InChIKey | JFCLUWJNIHQSFX-TUAOUCFPSA-N |
| XLogP | 2.21 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.34 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|