C15H27F3N2O2 — CID 86888627
1-(2-propan-2-ylcyclohexyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]urea (PubChem CID 86888627) has the molecular formula C15H27F3N2O2 and a molecular weight of 324.39 g/mol. Its IUPAC name is 1-(2-propan-2-ylcyclohexyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]urea.
| Compound Name | 1-(2-propan-2-ylcyclohexyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]urea |
|---|---|
| PubChem CID | 86888627 |
| Molecular Formula | C15H27F3N2O2 |
| Molecular Weight | 324.39 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 1-(2-propan-2-ylcyclohexyl)-3-[3-(2,2,2-trifluoroethoxy)propyl]urea |
| SMILES | CC(C)C1CCCCC1NC(=O)NCCCOCC(F)(F)F |
| InChI | InChI=1S/C15H27F3N2O2/c1-11(2)12-6-3-4-7-13(12)20-14(21)19-8-5-9-22-10-15(16,17)18/h11-13H,3-10H2,1-2H3,(H2,19,20,21) |
| InChIKey | RORHFIOSPFIEGG-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.39 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|