C22H29N3O2 — CID 136690347
1-[(Z)-(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-phenylurea (PubChem CID 136690347) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-[(Z)-(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-phenylurea.
| Compound Name | 1-[(Z)-(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-phenylurea |
|---|---|
| PubChem CID | 136690347 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 1-[(Z)-(3,5-ditert-butyl-2-hydroxyphenyl)methylideneamino]-3-phenylurea |
| SMILES | CC(C)(C)c1cc(/C=N\NC(=O)Nc2ccccc2)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C22H29N3O2/c1-21(2,3)16-12-15(19(26)18(13-16)22(4,5)6)14-23-25-20(27)24-17-10-8-7-9-11-17/h7-14,26H,1-6H3,(H2,24,25,27)/b23-14- |
| InChIKey | LLPHZPAWDKCFMA-UCQKPKSFSA-N |
| XLogP | 5.14 |
| TPSA | 73.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|