C38H54NO3P — CID 132605643
(1S)-N,N-dimethyl-1-phenyl-2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethanamine (PubChem CID 132605643) has the molecular formula C38H54NO3P and a molecular weight of 603.83 g/mol. Its IUPAC name is (1S)-N,N-dimethyl-1-phenyl-2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethanamine.
| Compound Name | (1S)-N,N-dimethyl-1-phenyl-2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethanamine |
|---|---|
| PubChem CID | 132605643 |
| Molecular Formula | C38H54NO3P |
| Molecular Weight | 603.83 g/mol |
| Exact Mass | 603.38 |
| IUPAC Name | (1S)-N,N-dimethyl-1-phenyl-2-(2,4,8,10-tetratert-butylbenzo[d][1,3,2]benzodioxaphosphepin-6-yl)oxyethanamine |
| SMILES | CN(C)[C@H](COp1oc2c(C(C)(C)C)cc(C(C)(C)C)cc2c2cc(C(C)(C)C)cc(C(C)(C)C)c2o1)c1ccccc1 |
| InChI | InChI=1S/C38H54NO3P/c1-35(2,3)26-20-28-29-21-27(36(4,5)6)23-31(38(10,11)12)34(29)42-43(41-33(28)30(22-26)37(7,8)9)40-24-32(39(13)14)25-18-16-15-17-19-25/h15-23,32H,24H2,1-14H3/t32-/m1/s1 |
| InChIKey | RLSIMRKTKKZZBK-JGCGQSQUSA-N |
| XLogP | 11.21 |
| TPSA | 38.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.83 |
| LogP ≤ 5 | 11.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |