C20H32O3 — CID 159476721
2,6-ditert-butyl-4-methylphenol;methyl 2-methylprop-2-enoate (PubChem CID 159476721) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is 2,6-ditert-butyl-4-methylphenol;methyl 2-methylprop-2-enoate.
| Compound Name | 2,6-ditert-butyl-4-methylphenol;methyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 159476721 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | 2,6-ditert-butyl-4-methylphenol;methyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC.Cc1cc(C(C)(C)C)c(O)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O.C5H8O2/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;1-4(2)5(6)7-3/h8-9,16H,1-7H3;1H2,2-3H3 |
| InChIKey | LWLZCLNQQBXKKF-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|