C22H26O3 — CID 20778466
[2-[1-(2-hydroxy-3,5-dimethylphenyl)ethyl]-4,6-dimethylphenyl] 2-methylprop-2-enoate (PubChem CID 20778466) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is [2-[1-(2-hydroxy-3,5-dimethylphenyl)ethyl]-4,6-dimethylphenyl] 2-methylprop-2-enoate.
| Compound Name | [2-[1-(2-hydroxy-3,5-dimethylphenyl)ethyl]-4,6-dimethylphenyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 20778466 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | [2-[1-(2-hydroxy-3,5-dimethylphenyl)ethyl]-4,6-dimethylphenyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)Oc1c(C)cc(C)cc1C(C)c1cc(C)cc(C)c1O |
| InChI | InChI=1S/C22H26O3/c1-12(2)22(24)25-21-16(6)9-14(4)11-19(21)17(7)18-10-13(3)8-15(5)20(18)23/h8-11,17,23H,1H2,2-7H3 |
| InChIKey | UVFKWMNOAOFESX-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|