C23H30O5 — CID 90300394
bis[2-(1-methoxyethyl)-4,6-dimethylphenyl] carbonate (PubChem CID 90300394) has the molecular formula C23H30O5 and a molecular weight of 386.49 g/mol. Its IUPAC name is bis[2-(1-methoxyethyl)-4,6-dimethylphenyl] carbonate.
| Compound Name | bis[2-(1-methoxyethyl)-4,6-dimethylphenyl] carbonate |
|---|---|
| PubChem CID | 90300394 |
| Molecular Formula | C23H30O5 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | bis[2-(1-methoxyethyl)-4,6-dimethylphenyl] carbonate |
| SMILES | COC(C)c1cc(C)cc(C)c1OC(=O)Oc1c(C)cc(C)cc1C(C)OC |
| InChI | InChI=1S/C23H30O5/c1-13-9-15(3)21(19(11-13)17(5)25-7)27-23(24)28-22-16(4)10-14(2)12-20(22)18(6)26-8/h9-12,17-18H,1-8H3 |
| InChIKey | XOPAZAOIUXVCBJ-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|