C63H102O6P2+2 — CID 161131069
bis(2,4-ditert-butyl-6-methylphenoxy)-ethyl-hydroxyphosphanium;bis(2,4-ditert-butyl-6-methylphenoxy)-hydroxy-methylphosphanium (PubChem CID 161131069) has the molecular formula C63H102O6P2+2 and a molecular weight of 1017.45 g/mol. Its IUPAC name is bis(2,4-ditert-butyl-6-methylphenoxy)-ethyl-hydroxyphosphanium;bis(2,4-ditert-butyl-6-methylphenoxy)-hydroxy-methylphosphanium.
| Compound Name | bis(2,4-ditert-butyl-6-methylphenoxy)-ethyl-hydroxyphosphanium;bis(2,4-ditert-butyl-6-methylphenoxy)-hydroxy-methylphosphanium |
|---|---|
| PubChem CID | 161131069 |
| Molecular Formula | C63H102O6P2+2 |
| Molecular Weight | 1017.45 g/mol |
| Exact Mass | 1016.71 |
| IUPAC Name | bis(2,4-ditert-butyl-6-methylphenoxy)-ethyl-hydroxyphosphanium;bis(2,4-ditert-butyl-6-methylphenoxy)-hydroxy-methylphosphanium |
| SMILES | CC[P+](O)(Oc1c(C)cc(C(C)(C)C)cc1C(C)(C)C)Oc1c(C)cc(C(C)(C)C)cc1C(C)(C)C.Cc1cc(C(C)(C)C)cc(C(C)(C)C)c1O[P+](C)(O)Oc1c(C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C32H52O3P.C31H50O3P/c1-16-36(33,34-27-21(2)17-23(29(4,5)6)19-25(27)31(10,11)12)35-28-22(3)18-24(30(7,8)9)20-26(28)32(13,14)15;1-20-16-22(28(3,4)5)18-24(30(9,10)11)26(20)33-35(15,32)34-27-21(2)17-23(29(6,7)8)19-25(27)31(12,13)14/h17-20,33H,16H2,1-15H3;16-19,32H,1-15H3/q2*+1 |
| InChIKey | NIEXQQVRSCPVGL-UHFFFAOYSA-N |
| XLogP | 19.06 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 71 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1017.45 |
| LogP ≤ 5 | 19.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|