About (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane
(2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane (PubChem CID 139747426) has the molecular formula C20H35AlO
and a molecular weight of 318.48 g/mol. Its IUPAC name is (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane.
Molecular Properties
| Compound Name | (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane |
| PubChem CID | 139747426 |
| Molecular Formula | C20H35AlO |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane |
| SMILES | Cc1cc(C)c(O[Al](CC(C)C)CC(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C12H18O.2C4H9.Al/c1-8-6-9(2)11(13)10(7-8)12(3,4)5;2*1-4(2)3;/h6-7,13H,1-5H3;2*4H,1H2,2-3H3;/q;;;+1/p-1 |
| InChIKey | HRLZPFIMSQPMSZ-UHFFFAOYSA-M |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane?
The IUPAC name of (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane (CID 139747426) is (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane.
What is the SMILES notation for (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane?
The canonical SMILES for (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane is Cc1cc(C)c(O[Al](CC(C)C)CC(C)C)c(C(C)(C)C)c1.
What is the InChIKey of (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane?
The InChIKey is HRLZPFIMSQPMSZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H18O.2C4H9.Al/c1-8-6-9(2)11(13)10(7-8)12(3,4)5;2*1-4(2)3;/h6-7,13H,1-5H3;2*4H,1H2,2-3H3;/q;;;+1/p-1.
What are the key properties of (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane?
(2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane has a molecular weight of 318.48 g/mol, XLogP of 6.28, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane is sourced from PubChem (CID 139747426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).