C20H35AlO — CID 139747426
(2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane (PubChem CID 139747426) has the molecular formula C20H35AlO and a molecular weight of 318.48 g/mol. Its IUPAC name is (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane.
| Compound Name | (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane |
|---|---|
| PubChem CID | 139747426 |
| Molecular Formula | C20H35AlO |
| Molecular Weight | 318.48 g/mol |
| Exact Mass | 318.25 |
| IUPAC Name | (2-tert-butyl-4,6-dimethylphenoxy)-bis(2-methylpropyl)alumane |
| SMILES | Cc1cc(C)c(O[Al](CC(C)C)CC(C)C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C12H18O.2C4H9.Al/c1-8-6-9(2)11(13)10(7-8)12(3,4)5;2*1-4(2)3;/h6-7,13H,1-5H3;2*4H,1H2,2-3H3;/q;;;+1/p-1 |
| InChIKey | HRLZPFIMSQPMSZ-UHFFFAOYSA-M |
| XLogP | 6.28 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.48 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |