C27H49AlO — CID 139981458
(2,6-ditert-butyl-4-methylphenoxy)-dihexylalumane (PubChem CID 139981458) has the molecular formula C27H49AlO and a molecular weight of 416.67 g/mol. Its IUPAC name is (2,6-ditert-butyl-4-methylphenoxy)-dihexylalumane.
| Compound Name | (2,6-ditert-butyl-4-methylphenoxy)-dihexylalumane |
|---|---|
| PubChem CID | 139981458 |
| Molecular Formula | C27H49AlO |
| Molecular Weight | 416.67 g/mol |
| Exact Mass | 416.36 |
| IUPAC Name | (2,6-ditert-butyl-4-methylphenoxy)-dihexylalumane |
| SMILES | CCCCCC[Al](CCCCCC)Oc1c(C(C)(C)C)cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/C15H24O.2C6H13.Al/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;2*1-3-5-6-4-2;/h8-9,16H,1-7H3;2*1,3-6H2,2H3;/q;;;+1/p-1 |
| InChIKey | RSEGLHGIWOMZCV-UHFFFAOYSA-M |
| XLogP | 9.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.67 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|