C36H59AlO2 — CID 141049928
bis(2,6-ditert-butyl-4-methylphenoxy)-hexylalumane (PubChem CID 141049928) has the molecular formula C36H59AlO2 and a molecular weight of 550.85 g/mol. Its IUPAC name is bis(2,6-ditert-butyl-4-methylphenoxy)-hexylalumane.
| Compound Name | bis(2,6-ditert-butyl-4-methylphenoxy)-hexylalumane |
|---|---|
| PubChem CID | 141049928 |
| Molecular Formula | C36H59AlO2 |
| Molecular Weight | 550.85 g/mol |
| Exact Mass | 550.43 |
| IUPAC Name | bis(2,6-ditert-butyl-4-methylphenoxy)-hexylalumane |
| SMILES | CCCCCC[Al](Oc1c(C(C)(C)C)cc(C)cc1C(C)(C)C)Oc1c(C(C)(C)C)cc(C)cc1C(C)(C)C |
| InChI | InChI=1S/2C15H24O.C6H13.Al/c2*1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;1-3-5-6-4-2;/h2*8-9,16H,1-7H3;1,3-6H2,2H3;/q;;;+2/p-2 |
| InChIKey | RRHYDQKRIQMZRR-UHFFFAOYSA-L |
| XLogP | 11.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.85 |
| LogP ≤ 5 | 11.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|