About 2-tert-butyl-1,4-dimethylbenzene;pentane
2-tert-butyl-1,4-dimethylbenzene;pentane (PubChem CID 142249583) has the molecular formula C17H30
and a molecular weight of 234.43 g/mol. Its IUPAC name is 2-tert-butyl-1,4-dimethylbenzene;pentane.
Molecular Properties
| Compound Name | 2-tert-butyl-1,4-dimethylbenzene;pentane |
| PubChem CID | 142249583 |
| Molecular Formula | C17H30 |
| Molecular Weight | 234.43 g/mol |
| Exact Mass | 234.23 |
| IUPAC Name | 2-tert-butyl-1,4-dimethylbenzene;pentane |
| SMILES | CCCCC.Cc1ccc(C)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C12H18.C5H12/c1-9-6-7-10(2)11(8-9)12(3,4)5;1-3-5-4-2/h6-8H,1-5H3;3-5H2,1-2H3 |
| InChIKey | JOPUFODJJDBDLK-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 234.43 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-tert-butyl-1,4-dimethylbenzene;pentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-1,4-dimethylbenzene;pentane?
The IUPAC name of 2-tert-butyl-1,4-dimethylbenzene;pentane (CID 142249583) is 2-tert-butyl-1,4-dimethylbenzene;pentane.
What is the SMILES notation for 2-tert-butyl-1,4-dimethylbenzene;pentane?
The canonical SMILES for 2-tert-butyl-1,4-dimethylbenzene;pentane is CCCCC.Cc1ccc(C)c(C(C)(C)C)c1.
What is the InChIKey of 2-tert-butyl-1,4-dimethylbenzene;pentane?
The InChIKey is JOPUFODJJDBDLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18.C5H12/c1-9-6-7-10(2)11(8-9)12(3,4)5;1-3-5-4-2/h6-8H,1-5H3;3-5H2,1-2H3.
What are the key properties of 2-tert-butyl-1,4-dimethylbenzene;pentane?
2-tert-butyl-1,4-dimethylbenzene;pentane has a molecular weight of 234.43 g/mol, XLogP of 5.80, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-1,4-dimethylbenzene;pentane is sourced from PubChem (CID 142249583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).