C17H26AlF3O4S — CID 134992041
[(2,6-ditert-butyl-4-methylphenoxy)-methylalumanyl] trifluoromethanesulfonate (PubChem CID 134992041) has the molecular formula C17H26AlF3O4S and a molecular weight of 410.43 g/mol. Its IUPAC name is [(2,6-ditert-butyl-4-methylphenoxy)-methylalumanyl] trifluoromethanesulfonate.
| Compound Name | [(2,6-ditert-butyl-4-methylphenoxy)-methylalumanyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 134992041 |
| Molecular Formula | C17H26AlF3O4S |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | [(2,6-ditert-butyl-4-methylphenoxy)-methylalumanyl] trifluoromethanesulfonate |
| SMILES | Cc1cc(C(C)(C)C)c(O[Al](C)OS(=O)(=O)C(F)(F)F)c(C(C)(C)C)c1 |
| InChI | InChI=1S/C15H24O.CHF3O3S.CH3.Al/c1-10-8-11(14(2,3)4)13(16)12(9-10)15(5,6)7;2-1(3,4)8(5,6)7;;/h8-9,16H,1-7H3;(H,5,6,7);1H3;/q;;;+2/p-2 |
| InChIKey | RKAIPMJITAKNNM-UHFFFAOYSA-L |
| XLogP | 4.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|