C22H34AlF5O — CID 87560332
dioctyl-(2,3,4,5,6-pentafluorophenoxy)alumane (PubChem CID 87560332) has the molecular formula C22H34AlF5O and a molecular weight of 436.49 g/mol. Its IUPAC name is dioctyl-(2,3,4,5,6-pentafluorophenoxy)alumane.
| Compound Name | dioctyl-(2,3,4,5,6-pentafluorophenoxy)alumane |
|---|---|
| PubChem CID | 87560332 |
| Molecular Formula | C22H34AlF5O |
| Molecular Weight | 436.49 g/mol |
| Exact Mass | 436.23 |
| IUPAC Name | dioctyl-(2,3,4,5,6-pentafluorophenoxy)alumane |
| SMILES | CCCCCCCC[Al](CCCCCCCC)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/2C8H17.C6HF5O.Al/c2*1-3-5-7-8-6-4-2;7-1-2(8)4(10)6(12)5(11)3(1)9;/h2*1,3-8H2,2H3;12H;/q;;;+1/p-1 |
| InChIKey | RBMABLWUMFXLGM-UHFFFAOYSA-M |
| XLogP | 8.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.49 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|