C47H74O3P+ — CID 161122899
tris(2,4-ditert-butyl-6-methylphenoxy)-ethylphosphanium (PubChem CID 161122899) has the molecular formula C47H74O3P+ and a molecular weight of 718.08 g/mol. Its IUPAC name is tris(2,4-ditert-butyl-6-methylphenoxy)-ethylphosphanium.
| Compound Name | tris(2,4-ditert-butyl-6-methylphenoxy)-ethylphosphanium |
|---|---|
| PubChem CID | 161122899 |
| Molecular Formula | C47H74O3P+ |
| Molecular Weight | 718.08 g/mol |
| Exact Mass | 717.54 |
| IUPAC Name | tris(2,4-ditert-butyl-6-methylphenoxy)-ethylphosphanium |
| SMILES | CC[P+](Oc1c(C)cc(C(C)(C)C)cc1C(C)(C)C)(Oc1c(C)cc(C(C)(C)C)cc1C(C)(C)C)Oc1c(C)cc(C(C)(C)C)cc1C(C)(C)C |
| InChI | InChI=1S/C47H74O3P/c1-23-51(48-39-30(2)24-33(42(5,6)7)27-36(39)45(14,15)16,49-40-31(3)25-34(43(8,9)10)28-37(40)46(17,18)19)50-41-32(4)26-35(44(11,12)13)29-38(41)47(20,21)22/h24-29H,23H2,1-22H3/q+1 |
| InChIKey | PLIUOSQJGCCAOX-UHFFFAOYSA-N |
| XLogP | 14.72 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.08 |
| LogP ≤ 5 | 14.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|