C15H23FO — CID 146426251
5-tert-butyl-1-fluoro-3-methyl-2-(2-methylpropoxy)benzene (PubChem CID 146426251) has the molecular formula C15H23FO and a molecular weight of 238.35 g/mol. Its IUPAC name is 5-tert-butyl-1-fluoro-3-methyl-2-(2-methylpropoxy)benzene.
| Compound Name | 5-tert-butyl-1-fluoro-3-methyl-2-(2-methylpropoxy)benzene |
|---|---|
| PubChem CID | 146426251 |
| Molecular Formula | C15H23FO |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | 5-tert-butyl-1-fluoro-3-methyl-2-(2-methylpropoxy)benzene |
| SMILES | Cc1cc(C(C)(C)C)cc(F)c1OCC(C)C |
| InChI | InChI=1S/C15H23FO/c1-10(2)9-17-14-11(3)7-12(8-13(14)16)15(4,5)6/h7-8,10H,9H2,1-6H3 |
| InChIKey | SQAZRPNRHXLOTL-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |