C14H21FO — CID 143945190
5-tert-butyl-2-(2-fluoroethoxy)-1,3-dimethylbenzene (PubChem CID 143945190) has the molecular formula C14H21FO and a molecular weight of 224.32 g/mol. Its IUPAC name is 5-tert-butyl-2-(2-fluoroethoxy)-1,3-dimethylbenzene.
| Compound Name | 5-tert-butyl-2-(2-fluoroethoxy)-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 143945190 |
| Molecular Formula | C14H21FO |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.16 |
| IUPAC Name | 5-tert-butyl-2-(2-fluoroethoxy)-1,3-dimethylbenzene |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1OCCF |
| InChI | InChI=1S/C14H21FO/c1-10-8-12(14(3,4)5)9-11(2)13(10)16-7-6-15/h8-9H,6-7H2,1-5H3 |
| InChIKey | MSPCEKZQVZVBFD-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |