C11H14ClFO3S — CID 80699431
4-(2-fluoroethoxy)-2,3,5-trimethylbenzenesulfonyl chloride (PubChem CID 80699431) has the molecular formula C11H14ClFO3S and a molecular weight of 280.75 g/mol. Its IUPAC name is 4-(2-fluoroethoxy)-2,3,5-trimethylbenzenesulfonyl chloride.
| Compound Name | 4-(2-fluoroethoxy)-2,3,5-trimethylbenzenesulfonyl chloride |
|---|---|
| PubChem CID | 80699431 |
| Molecular Formula | C11H14ClFO3S |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | 4-(2-fluoroethoxy)-2,3,5-trimethylbenzenesulfonyl chloride |
| SMILES | Cc1cc(S(=O)(=O)Cl)c(C)c(C)c1OCCF |
| InChI | InChI=1S/C11H14ClFO3S/c1-7-6-10(17(12,14)15)8(2)9(3)11(7)16-5-4-13/h6H,4-5H2,1-3H3 |
| InChIKey | DREHWWFPPBMCMZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |